C18H16N4O2 — CID 46450468
1-phenyl-N'-(2-phenylacetyl)pyrazole-3-carbohydrazide (PubChem CID 46450468) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-phenyl-N'-(2-phenylacetyl)pyrazole-3-carbohydrazide.
| Compound Name | 1-phenyl-N'-(2-phenylacetyl)pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 46450468 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-phenyl-N'-(2-phenylacetyl)pyrazole-3-carbohydrazide |
| SMILES | O=C(Cc1ccccc1)NNC(=O)c1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H16N4O2/c23-17(13-14-7-3-1-4-8-14)19-20-18(24)16-11-12-22(21-16)15-9-5-2-6-10-15/h1-12H,13H2,(H,19,23)(H,20,24) |
| InChIKey | PTZMDJQRRRDJBO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|