C18H14F2N4O2 — CID 47879002
1-(3-fluorophenyl)-N'-[2-(4-fluorophenyl)acetyl]pyrazole-3-carbohydrazide (PubChem CID 47879002) has the molecular formula C18H14F2N4O2 and a molecular weight of 356.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N'-[2-(4-fluorophenyl)acetyl]pyrazole-3-carbohydrazide.
| Compound Name | 1-(3-fluorophenyl)-N'-[2-(4-fluorophenyl)acetyl]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 47879002 |
| Molecular Formula | C18H14F2N4O2 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-(3-fluorophenyl)-N'-[2-(4-fluorophenyl)acetyl]pyrazole-3-carbohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)c1ccn(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C18H14F2N4O2/c19-13-6-4-12(5-7-13)10-17(25)21-22-18(26)16-8-9-24(23-16)15-3-1-2-14(20)11-15/h1-9,11H,10H2,(H,21,25)(H,22,26) |
| InChIKey | VBHHPLJYAVLQDW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|