C13H11FN2O2 — CID 86846505
prop-2-enyl 1-(3-fluorophenyl)pyrazole-3-carboxylate (PubChem CID 86846505) has the molecular formula C13H11FN2O2 and a molecular weight of 246.24 g/mol. Its IUPAC name is prop-2-enyl 1-(3-fluorophenyl)pyrazole-3-carboxylate.
| Compound Name | prop-2-enyl 1-(3-fluorophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 86846505 |
| Molecular Formula | C13H11FN2O2 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | prop-2-enyl 1-(3-fluorophenyl)pyrazole-3-carboxylate |
| SMILES | C=CCOC(=O)c1ccn(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H11FN2O2/c1-2-8-18-13(17)12-6-7-16(15-12)11-5-3-4-10(14)9-11/h2-7,9H,1,8H2 |
| InChIKey | VQOKPHFKGIYHOR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|