C19H14F2N4O2 — CID 166405448
1-(3-fluorophenyl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-3-carboxamide (PubChem CID 166405448) has the molecular formula C19H14F2N4O2 and a molecular weight of 368.34 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166405448 |
| Molecular Formula | C19H14F2N4O2 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-3-carboxamide |
| SMILES | C=CC(=O)Nc1cc(NC(=O)c2ccn(-c3cccc(F)c3)n2)ccc1F |
| InChI | InChI=1S/C19H14F2N4O2/c1-2-18(26)23-17-11-13(6-7-15(17)21)22-19(27)16-8-9-25(24-16)14-5-3-4-12(20)10-14/h2-11H,1H2,(H,22,27)(H,23,26) |
| InChIKey | HWXJFDQCDXIWHH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|