C17H16N4O4 — CID 17415770
N'-(2,5-dimethylfuran-3-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide (PubChem CID 17415770) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is N'-(2,5-dimethylfuran-3-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | N'-(2,5-dimethylfuran-3-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 17415770 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N'-(2,5-dimethylfuran-3-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2nn(-c3ccccc3)cc2O)c(C)o1 |
| InChI | InChI=1S/C17H16N4O4/c1-10-8-13(11(2)25-10)16(23)18-19-17(24)15-14(22)9-21(20-15)12-6-4-3-5-7-12/h3-9,22H,1-2H3,(H,18,23)(H,19,24) |
| InChIKey | ORTPOIYQLKDYHL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|