C21H18N6O4S — CID 55527463
N'-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyridine-3-carbohydrazide (PubChem CID 55527463) has the molecular formula C21H18N6O4S and a molecular weight of 450.48 g/mol. Its IUPAC name is N'-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyridine-3-carbohydrazide.
| Compound Name | N'-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 55527463 |
| Molecular Formula | C21H18N6O4S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N'-(4-hydroxy-1-phenylpyrazole-3-carbonyl)-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyridine-3-carbohydrazide |
| SMILES | Cc1cc(CSc2ncccc2C(=O)NNC(=O)c2nn(-c3ccccc3)cc2O)no1 |
| InChI | InChI=1S/C21H18N6O4S/c1-13-10-14(26-31-13)12-32-21-16(8-5-9-22-21)19(29)23-24-20(30)18-17(28)11-27(25-18)15-6-3-2-4-7-15/h2-11,28H,12H2,1H3,(H,23,29)(H,24,30) |
| InChIKey | FEZSNAVBPPUFDI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|