C25H24N2O5 — CID 4955159
3-(2-phenoxyethoxy)-N'-(4-prop-2-enoxybenzoyl)benzohydrazide (PubChem CID 4955159) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-(2-phenoxyethoxy)-N'-(4-prop-2-enoxybenzoyl)benzohydrazide.
| Compound Name | 3-(2-phenoxyethoxy)-N'-(4-prop-2-enoxybenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 4955159 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3-(2-phenoxyethoxy)-N'-(4-prop-2-enoxybenzoyl)benzohydrazide |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)c2cccc(OCCOc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-2-15-30-22-13-11-19(12-14-22)24(28)26-27-25(29)20-7-6-10-23(18-20)32-17-16-31-21-8-4-3-5-9-21/h2-14,18H,1,15-17H2,(H,26,28)(H,27,29) |
| InChIKey | XBJQZYGFCYGUKD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|