C23H21NO3 — CID 17086755
4-phenylmethoxy-N-(3-prop-2-enoxyphenyl)benzamide (PubChem CID 17086755) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-phenylmethoxy-N-(3-prop-2-enoxyphenyl)benzamide.
| Compound Name | 4-phenylmethoxy-N-(3-prop-2-enoxyphenyl)benzamide |
|---|---|
| PubChem CID | 17086755 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-phenylmethoxy-N-(3-prop-2-enoxyphenyl)benzamide |
| SMILES | C=CCOc1cccc(NC(=O)c2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H21NO3/c1-2-15-26-22-10-6-9-20(16-22)24-23(25)19-11-13-21(14-12-19)27-17-18-7-4-3-5-8-18/h2-14,16H,1,15,17H2,(H,24,25) |
| InChIKey | USKQUFNIZQSRAV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|