C17H17NO3S — CID 86835440
4-methylsulfinyl-N-(3-prop-2-enoxyphenyl)benzamide (PubChem CID 86835440) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 4-methylsulfinyl-N-(3-prop-2-enoxyphenyl)benzamide.
| Compound Name | 4-methylsulfinyl-N-(3-prop-2-enoxyphenyl)benzamide |
|---|---|
| PubChem CID | 86835440 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-methylsulfinyl-N-(3-prop-2-enoxyphenyl)benzamide |
| SMILES | C=CCOc1cccc(NC(=O)c2ccc(S(C)=O)cc2)c1 |
| InChI | InChI=1S/C17H17NO3S/c1-3-11-21-15-6-4-5-14(12-15)18-17(19)13-7-9-16(10-8-13)22(2)20/h3-10,12H,1,11H2,2H3,(H,18,19) |
| InChIKey | QLQZSDLWOXKYAQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|