C23H21N5O5S — CID 46657516
N'-[2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide (PubChem CID 46657516) has the molecular formula C23H21N5O5S and a molecular weight of 479.52 g/mol. Its IUPAC name is N'-[2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | N'-[2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 46657516 |
| Molecular Formula | C23H21N5O5S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N'-[2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
| SMILES | COc1ccc(-c2nc(CC(=O)NNC(=O)c3nn(-c4ccccc4)cc3O)cs2)cc1OC |
| InChI | InChI=1S/C23H21N5O5S/c1-32-18-9-8-14(10-19(18)33-2)23-24-15(13-34-23)11-20(30)25-26-22(31)21-17(29)12-28(27-21)16-6-4-3-5-7-16/h3-10,12-13,29H,11H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | MYWLNHBZHCMHSJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|