C26H24N4O4 — CID 25475855
3-(3,4-dimethoxyphenyl)-1-phenyl-N'-(2-phenylacetyl)pyrazole-4-carbohydrazide (PubChem CID 25475855) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-phenyl-N'-(2-phenylacetyl)pyrazole-4-carbohydrazide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-phenyl-N'-(2-phenylacetyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 25475855 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-phenyl-N'-(2-phenylacetyl)pyrazole-4-carbohydrazide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NNC(=O)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C26H24N4O4/c1-33-22-14-13-19(16-23(22)34-2)25-21(17-30(29-25)20-11-7-4-8-12-20)26(32)28-27-24(31)15-18-9-5-3-6-10-18/h3-14,16-17H,15H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | BYESJYIZHLHIPQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|