C24H24N6O3 — CID 26121098
3-(3,4-dimethoxyphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)-1-phenylpyrazole-4-carbohydrazide (PubChem CID 26121098) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)-1-phenylpyrazole-4-carbohydrazide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)-1-phenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 26121098 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)-1-phenylpyrazole-4-carbohydrazide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NNc2nc(C)cc(C)n2)cc1OC |
| InChI | InChI=1S/C24H24N6O3/c1-15-12-16(2)26-24(25-15)28-27-23(31)19-14-30(18-8-6-5-7-9-18)29-22(19)17-10-11-20(32-3)21(13-17)33-4/h5-14H,1-4H3,(H,27,31)(H,25,26,28) |
| InChIKey | VIAVVDIAMLHKLO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|