C22H21N5O5 — CID 46643393
N-[3-[[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 46643393) has the molecular formula C22H21N5O5 and a molecular weight of 435.44 g/mol. Its IUPAC name is N-[3-[[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 46643393 |
| Molecular Formula | C22H21N5O5 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-[3-[[(4-hydroxy-1-phenylpyrazole-3-carbonyl)amino]carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(NNC(=O)c1nn(-c2ccccc2)cc1O)c1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C22H21N5O5/c28-17-13-27(16-8-2-1-3-9-16)26-19(17)22(31)25-24-20(29)14-6-4-7-15(12-14)23-21(30)18-10-5-11-32-18/h1-4,6-9,12-13,18,28H,5,10-11H2,(H,23,30)(H,24,29)(H,25,31) |
| InChIKey | CFLGBQQXERYXKB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|