C13H16N2O — CID 14323120
N'-phenylcyclohex-3-ene-1-carbohydrazide (PubChem CID 14323120) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N'-phenylcyclohex-3-ene-1-carbohydrazide.
| Compound Name | N'-phenylcyclohex-3-ene-1-carbohydrazide |
|---|---|
| PubChem CID | 14323120 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N'-phenylcyclohex-3-ene-1-carbohydrazide |
| SMILES | O=C(NNc1ccccc1)C1CC=CCC1 |
| InChI | InChI=1S/C13H16N2O/c16-13(11-7-3-1-4-8-11)15-14-12-9-5-2-6-10-12/h1-3,5-6,9-11,14H,4,7-8H2,(H,15,16) |
| InChIKey | ROZQUANHRWMAMG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|