C13H20N2O2 — CID 51983300
(1S)-N'-(cyclopentanecarbonyl)cyclohex-3-ene-1-carbohydrazide (PubChem CID 51983300) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S)-N'-(cyclopentanecarbonyl)cyclohex-3-ene-1-carbohydrazide.
| Compound Name | (1S)-N'-(cyclopentanecarbonyl)cyclohex-3-ene-1-carbohydrazide |
|---|---|
| PubChem CID | 51983300 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (1S)-N'-(cyclopentanecarbonyl)cyclohex-3-ene-1-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1CC=CCC1)C1CCCC1 |
| InChI | InChI=1S/C13H20N2O2/c16-12(10-6-2-1-3-7-10)14-15-13(17)11-8-4-5-9-11/h1-2,10-11H,3-9H2,(H,14,16)(H,15,17)/t10-/m1/s1 |
| InChIKey | RFASIOKYWTWQJO-SNVBAGLBSA-N |
| XLogP | 1.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|