C8H13NO — CID 156676783
N-(trideuteriomethyl)cyclohex-3-ene-1-carboxamide (PubChem CID 156676783) has the molecular formula C8H13NO and a molecular weight of 142.22 g/mol. Its IUPAC name is N-(trideuteriomethyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(trideuteriomethyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 156676783 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | N-(trideuteriomethyl)cyclohex-3-ene-1-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)C1CC=CCC1 |
| InChI | InChI=1S/C8H13NO/c1-9-8(10)7-5-3-2-4-6-7/h2-3,7H,4-6H2,1H3,(H,9,10)/i1D3 |
| InChIKey | DXXQJVHTEFQHMF-FIBGUPNXSA-N |
| XLogP | 1.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|