C10H15NO3 — CID 24705199
2-(cyclohex-3-ene-1-carbonylamino)propanoic acid (PubChem CID 24705199) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(cyclohex-3-ene-1-carbonylamino)propanoic acid.
| Compound Name | 2-(cyclohex-3-ene-1-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 24705199 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-(cyclohex-3-ene-1-carbonylamino)propanoic acid |
| SMILES | CC(NC(=O)C1CC=CCC1)C(=O)O |
| InChI | InChI=1S/C10H15NO3/c1-7(10(13)14)11-9(12)8-5-3-2-4-6-8/h2-3,7-8H,4-6H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | GWPJDZYZMSNFOR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|