C11H16O2 — CID 177407584
(3E,7Z)-cyclodeca-3,7-diene-1-carboxylic acid (PubChem CID 177407584) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3E,7Z)-cyclodeca-3,7-diene-1-carboxylic acid.
| Compound Name | (3E,7Z)-cyclodeca-3,7-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 177407584 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3E,7Z)-cyclodeca-3,7-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C/C=C/CC/C=C\CC1 |
| InChI | InChI=1S/C11H16O2/c12-11(13)10-8-6-4-2-1-3-5-7-9-10/h2,4-5,7,10H,1,3,6,8-9H2,(H,12,13)/b4-2-,7-5+ |
| InChIKey | CLUNRJRUFGJROO-USMLMTEFSA-N |
| XLogP | 2.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|