C22H31NO4 — CID 162157534
(1R)-cyclohex-3-ene-1-carboxylic acid;cyclohex-3-ene-1-carboxylic acid;(1S)-1-phenylethanamine (PubChem CID 162157534) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is (1R)-cyclohex-3-ene-1-carboxylic acid;cyclohex-3-ene-1-carboxylic acid;(1S)-1-phenylethanamine.
| Compound Name | (1R)-cyclohex-3-ene-1-carboxylic acid;cyclohex-3-ene-1-carboxylic acid;(1S)-1-phenylethanamine |
|---|---|
| PubChem CID | 162157534 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (1R)-cyclohex-3-ene-1-carboxylic acid;cyclohex-3-ene-1-carboxylic acid;(1S)-1-phenylethanamine |
| SMILES | C[C@H](N)c1ccccc1.O=C(O)C1CC=CCC1.O=C(O)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C8H11N.2C7H10O2/c1-7(9)8-5-3-2-4-6-8;2*8-7(9)6-4-2-1-3-5-6/h2-7H,9H2,1H3;2*1-2,6H,3-5H2,(H,8,9)/t7-;6-;/m00./s1 |
| InChIKey | ZMAKDNRNZJZQKS-ROYXELRDSA-N |
| XLogP | 4.56 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|