C18H25NO — CID 95220593
(1R)-N-(2-phenylethyl)-N-propan-2-ylcyclohex-3-ene-1-carboxamide (PubChem CID 95220593) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (1R)-N-(2-phenylethyl)-N-propan-2-ylcyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-(2-phenylethyl)-N-propan-2-ylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 95220593 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (1R)-N-(2-phenylethyl)-N-propan-2-ylcyclohex-3-ene-1-carboxamide |
| SMILES | CC(C)N(CCc1ccccc1)C(=O)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C18H25NO/c1-15(2)19(14-13-16-9-5-3-6-10-16)18(20)17-11-7-4-8-12-17/h3-7,9-10,15,17H,8,11-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | JXGQEMAIIFHHDA-KRWDZBQOSA-N |
| XLogP | 3.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|