C15H20N2O3S — CID 94192956
(1R)-N-[benzyl(methyl)sulfamoyl]cyclohex-3-ene-1-carboxamide (PubChem CID 94192956) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is (1R)-N-[benzyl(methyl)sulfamoyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[benzyl(methyl)sulfamoyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 94192956 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (1R)-N-[benzyl(methyl)sulfamoyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)NC(=O)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C15H20N2O3S/c1-17(12-13-8-4-2-5-9-13)21(19,20)16-15(18)14-10-6-3-7-11-14/h2-6,8-9,14H,7,10-12H2,1H3,(H,16,18)/t14-/m0/s1 |
| InChIKey | ZKAXKBQYGWFGBN-AWEZNQCLSA-N |
| XLogP | 1.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|