C15H18N2O2 — CID 766579
(1S)-N'-(2-phenylacetyl)cyclohex-3-ene-1-carbohydrazide (PubChem CID 766579) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (1S)-N'-(2-phenylacetyl)cyclohex-3-ene-1-carbohydrazide.
| Compound Name | (1S)-N'-(2-phenylacetyl)cyclohex-3-ene-1-carbohydrazide |
|---|---|
| PubChem CID | 766579 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (1S)-N'-(2-phenylacetyl)cyclohex-3-ene-1-carbohydrazide |
| SMILES | O=C(Cc1ccccc1)NNC(=O)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C15H18N2O2/c18-14(11-12-7-3-1-4-8-12)16-17-15(19)13-9-5-2-6-10-13/h1-5,7-8,13H,6,9-11H2,(H,16,18)(H,17,19)/t13-/m1/s1 |
| InChIKey | MICKIOCYIUPUDX-CYBMUJFWSA-N |
| XLogP | 1.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|