About cyclohexanecarboxylic acid;(1R)-1-phenylethanamine
cyclohexanecarboxylic acid;(1R)-1-phenylethanamine (PubChem CID 129012028) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is cyclohexanecarboxylic acid;(1R)-1-phenylethanamine.
Molecular Properties
| Compound Name | cyclohexanecarboxylic acid;(1R)-1-phenylethanamine |
| PubChem CID | 129012028 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | cyclohexanecarboxylic acid;(1R)-1-phenylethanamine |
| SMILES | C[C@@H](N)c1ccccc1.O=C(O)C1CCCCC1 |
| InChI | InChI=1S/C8H11N.C7H12O2/c1-7(9)8-5-3-2-4-6-8;8-7(9)6-4-2-1-3-5-6/h2-7H,9H2,1H3;6H,1-5H2,(H,8,9)/t7-;/m1./s1 |
| InChIKey | ZFVRRIVHMDEBRM-OGFXRTJISA-N |
| XLogP | 3.36 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexanecarboxylic acid;(1R)-1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanecarboxylic acid;(1R)-1-phenylethanamine?
The IUPAC name of cyclohexanecarboxylic acid;(1R)-1-phenylethanamine (CID 129012028) is cyclohexanecarboxylic acid;(1R)-1-phenylethanamine.
What is the SMILES notation for cyclohexanecarboxylic acid;(1R)-1-phenylethanamine?
The canonical SMILES for cyclohexanecarboxylic acid;(1R)-1-phenylethanamine is C[C@@H](N)c1ccccc1.O=C(O)C1CCCCC1.
What is the InChIKey of cyclohexanecarboxylic acid;(1R)-1-phenylethanamine?
The InChIKey is ZFVRRIVHMDEBRM-OGFXRTJISA-N. The full InChI is InChI=1S/C8H11N.C7H12O2/c1-7(9)8-5-3-2-4-6-8;8-7(9)6-4-2-1-3-5-6/h2-7H,9H2,1H3;6H,1-5H2,(H,8,9)/t7-;/m1./s1.
What are the key properties of cyclohexanecarboxylic acid;(1R)-1-phenylethanamine?
cyclohexanecarboxylic acid;(1R)-1-phenylethanamine has a molecular weight of 249.35 g/mol, XLogP of 3.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanecarboxylic acid;(1R)-1-phenylethanamine is sourced from PubChem (CID 129012028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).