About cyclohexanecarboxylic acid;N-methylbenzamide
cyclohexanecarboxylic acid;N-methylbenzamide (PubChem CID 70533648) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is cyclohexanecarboxylic acid;N-methylbenzamide.
Molecular Properties
| Compound Name | cyclohexanecarboxylic acid;N-methylbenzamide |
| PubChem CID | 70533648 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | cyclohexanecarboxylic acid;N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1.O=C(O)C1CCCCC1 |
| InChI | InChI=1S/C8H9NO.C7H12O2/c1-9-8(10)7-5-3-2-4-6-7;8-7(9)6-4-2-1-3-5-6/h2-6H,1H3,(H,9,10);6H,1-5H2,(H,8,9) |
| InChIKey | RSGCWAIJRJBODC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexanecarboxylic acid;N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanecarboxylic acid;N-methylbenzamide?
The IUPAC name of cyclohexanecarboxylic acid;N-methylbenzamide (CID 70533648) is cyclohexanecarboxylic acid;N-methylbenzamide.
What is the SMILES notation for cyclohexanecarboxylic acid;N-methylbenzamide?
The canonical SMILES for cyclohexanecarboxylic acid;N-methylbenzamide is CNC(=O)c1ccccc1.O=C(O)C1CCCCC1.
What is the InChIKey of cyclohexanecarboxylic acid;N-methylbenzamide?
The InChIKey is RSGCWAIJRJBODC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C7H12O2/c1-9-8(10)7-5-3-2-4-6-7;8-7(9)6-4-2-1-3-5-6/h2-6H,1H3,(H,9,10);6H,1-5H2,(H,8,9).
What are the key properties of cyclohexanecarboxylic acid;N-methylbenzamide?
cyclohexanecarboxylic acid;N-methylbenzamide has a molecular weight of 263.34 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanecarboxylic acid;N-methylbenzamide is sourced from PubChem (CID 70533648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).