About CID 66812751
CID 66812751 (PubChem CID 66812751) has the molecular formula C8H11BNO3
and a molecular weight of 179.99 g/mol.
Molecular Properties
| Compound Name | CID 66812751 |
| PubChem CID | 66812751 |
| Molecular Formula | C8H11BNO3 |
| Molecular Weight | 179.99 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1ccccc1.O[B]O |
| InChI | InChI=1S/C8H9NO.BH2O2/c1-9-8(10)7-5-3-2-4-6-7;2-1-3/h2-6H,1H3,(H,9,10);2-3H |
| InChIKey | JYKRJFCNAUMBIX-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.99 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66812751 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66812751?
The IUPAC name of CID 66812751 (CID 66812751) is not available.
What is the SMILES notation for CID 66812751?
The canonical SMILES for CID 66812751 is CNC(=O)c1ccccc1.O[B]O.
What is the InChIKey of CID 66812751?
The InChIKey is JYKRJFCNAUMBIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.BH2O2/c1-9-8(10)7-5-3-2-4-6-7;2-1-3/h2-6H,1H3,(H,9,10);2-3H.
What are the key properties of CID 66812751?
CID 66812751 has a molecular weight of 179.99 g/mol, XLogP of -0.45, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66812751 is sourced from PubChem (CID 66812751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).