C25H34O — CID 140793632
bis[(3E,5E,9E)-cyclododeca-3,5,9-trien-1-yl]methanone (PubChem CID 140793632) has the molecular formula C25H34O and a molecular weight of 350.55 g/mol. Its IUPAC name is bis[(3E,5E,9E)-cyclododeca-3,5,9-trien-1-yl]methanone.
| Compound Name | bis[(3E,5E,9E)-cyclododeca-3,5,9-trien-1-yl]methanone |
|---|---|
| PubChem CID | 140793632 |
| Molecular Formula | C25H34O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | bis[(3E,5E,9E)-cyclododeca-3,5,9-trien-1-yl]methanone |
| SMILES | O=C(C1C/C=C/C=C/CC/C=C/CC1)C1C/C=C/C=C/CC/C=C/CC1 |
| InChI | InChI=1S/C25H34O/c26-25(23-19-15-11-7-3-1-4-8-12-16-20-23)24-21-17-13-9-5-2-6-10-14-18-22-24/h3,5,7-15,17,23-24H,1-2,4,6,16,18-22H2/b7-3+,9-5+,12-8+,14-10+,15-11+,17-13+ |
| InChIKey | MSKQHTAIJSXMJD-KKCMIUMPSA-N |
| XLogP | 7.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|