About methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen
methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen (PubChem CID 159841486) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen.
Molecular Properties
| Compound Name | methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen |
| PubChem CID | 159841486 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen |
| SMILES | COC(=O)C1CC=CCC1.COC(=O)C1CCCCC1.[H][H] |
| InChI | InChI=1S/C8H14O2.C8H12O2.H2/c2*1-10-8(9)7-5-3-2-4-6-7;/h7H,2-6H2,1H3;2-3,7H,4-6H2,1H3;1H |
| InChIKey | NOSRAFHXDNOEMQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen?
The IUPAC name of methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen (CID 159841486) is methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen.
What is the SMILES notation for methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen?
The canonical SMILES for methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen is COC(=O)C1CC=CCC1.COC(=O)C1CCCCC1.[H][H].
What is the InChIKey of methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen?
The InChIKey is NOSRAFHXDNOEMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C8H12O2.H2/c2*1-10-8(9)7-5-3-2-4-6-7;/h7H,2-6H2,1H3;2-3,7H,4-6H2,1H3;1H.
What are the key properties of methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen?
methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen has a molecular weight of 284.40 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen is sourced from PubChem (CID 159841486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).