methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen

C16H28O4 — CID 159841486

IUPACmethyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen
SMILESCOC(=O)C1CC=CCC1.COC(=O)C1CCCCC1.[H][H]
InChIInChI=1S/C8H14O2.C8H12O2.H2/c2*1-10-8(9)7-5-3-2-4-6-7;/h7H,2-6H2,1H3;2-3,7H,4-6H2,1H3;1H
InChIKeyNOSRAFHXDNOEMQ-UHFFFAOYSA-N
MW284.40 g/mol
LogP3.50
Rot. Bonds2

About methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen

methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen (PubChem CID 159841486) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen.

Molecular Properties

Compound Namemethyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen
PubChem CID159841486
Molecular FormulaC16H28O4
Molecular Weight284.40 g/mol
Exact Mass284.20
IUPAC Namemethyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen
SMILESCOC(=O)C1CC=CCC1.COC(=O)C1CCCCC1.[H][H]
InChIInChI=1S/C8H14O2.C8H12O2.H2/c2*1-10-8(9)7-5-3-2-4-6-7;/h7H,2-6H2,1H3;2-3,7H,4-6H2,1H3;1H
InChIKeyNOSRAFHXDNOEMQ-UHFFFAOYSA-N
XLogP3.50
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.40
LogP ≤ 53.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen?
The IUPAC name of methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen (CID 159841486) is methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen.
What is the SMILES notation for methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen?
The canonical SMILES for methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen is COC(=O)C1CC=CCC1.COC(=O)C1CCCCC1.[H][H].
What is the InChIKey of methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen?
The InChIKey is NOSRAFHXDNOEMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C8H12O2.H2/c2*1-10-8(9)7-5-3-2-4-6-7;/h7H,2-6H2,1H3;2-3,7H,4-6H2,1H3;1H.
What are the key properties of methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen?
methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen has a molecular weight of 284.40 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl cyclohexanecarboxylate;methyl cyclohex-3-ene-1-carboxylate;molecular hydrogen is sourced from PubChem (CID 159841486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).