About ethane;methyl cyclohexanecarboxylate
ethane;methyl cyclohexanecarboxylate (PubChem CID 90871014) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is ethane;methyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | ethane;methyl cyclohexanecarboxylate |
| PubChem CID | 90871014 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | ethane;methyl cyclohexanecarboxylate |
| SMILES | CC.COC(=O)C1CCCCC1 |
| InChI | InChI=1S/C8H14O2.C2H6/c1-10-8(9)7-5-3-2-4-6-7;1-2/h7H,2-6H2,1H3;1-2H3 |
| InChIKey | RMXACTLMNXGRLX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl cyclohexanecarboxylate?
The IUPAC name of ethane;methyl cyclohexanecarboxylate (CID 90871014) is ethane;methyl cyclohexanecarboxylate.
What is the SMILES notation for ethane;methyl cyclohexanecarboxylate?
The canonical SMILES for ethane;methyl cyclohexanecarboxylate is CC.COC(=O)C1CCCCC1.
What is the InChIKey of ethane;methyl cyclohexanecarboxylate?
The InChIKey is RMXACTLMNXGRLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C2H6/c1-10-8(9)7-5-3-2-4-6-7;1-2/h7H,2-6H2,1H3;1-2H3.
What are the key properties of ethane;methyl cyclohexanecarboxylate?
ethane;methyl cyclohexanecarboxylate has a molecular weight of 172.27 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl cyclohexanecarboxylate is sourced from PubChem (CID 90871014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).