About cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide)
cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide) (PubChem CID 160909551) has the molecular formula C13H22O10S2
and a molecular weight of 402.44 g/mol. Its IUPAC name is cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide).
Molecular Properties
| Compound Name | cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide) |
| PubChem CID | 160909551 |
| Molecular Formula | C13H22O10S2 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide) |
| SMILES | COC(=O)C1CCCC1.O=C(O)C1CCCC1.O=S(=O)=O.O=S(=O)=O |
| InChI | InChI=1S/C7H12O2.C6H10O2.2O3S/c1-9-7(8)6-4-2-3-5-6;7-6(8)5-3-1-2-4-5;2*1-4(2)3/h6H,2-5H2,1H3;5H,1-4H2,(H,7,8);; |
| InChIKey | SQPAWBNHDRZQQY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 166.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide)?
The IUPAC name of cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide) (CID 160909551) is cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide).
What is the SMILES notation for cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide)?
The canonical SMILES for cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide) is COC(=O)C1CCCC1.O=C(O)C1CCCC1.O=S(=O)=O.O=S(=O)=O.
What is the InChIKey of cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide)?
The InChIKey is SQPAWBNHDRZQQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C6H10O2.2O3S/c1-9-7(8)6-4-2-3-5-6;7-6(8)5-3-1-2-4-5;2*1-4(2)3/h6H,2-5H2,1H3;5H,1-4H2,(H,7,8);;.
What are the key properties of cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide)?
cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide) has a molecular weight of 402.44 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanecarboxylic acid;methyl cyclopentanecarboxylate;bis(sulfur trioxide) is sourced from PubChem (CID 160909551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).