About methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate
methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate (PubChem CID 158261910) has the molecular formula C15H27NO4
and a molecular weight of 285.38 g/mol. Its IUPAC name is methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate |
| PubChem CID | 158261910 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCCCC1.COC(=O)C1CCNCC1 |
| InChI | InChI=1S/C8H14O2.C7H13NO2/c1-10-8(9)7-5-3-2-4-6-7;1-10-7(9)6-2-4-8-5-3-6/h7H,2-6H2,1H3;6,8H,2-5H2,1H3 |
| InChIKey | GHYXIWMIPYHUKZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate?
The IUPAC name of methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate (CID 158261910) is methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate.
What is the SMILES notation for methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate?
The canonical SMILES for methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate is COC(=O)C1CCCCC1.COC(=O)C1CCNCC1.
What is the InChIKey of methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate?
The InChIKey is GHYXIWMIPYHUKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C7H13NO2/c1-10-8(9)7-5-3-2-4-6-7;1-10-7(9)6-2-4-8-5-3-6/h7H,2-6H2,1H3;6,8H,2-5H2,1H3.
What are the key properties of methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate?
methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate has a molecular weight of 285.38 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl cyclohexanecarboxylate;methyl piperidine-4-carboxylate is sourced from PubChem (CID 158261910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).