C19H36O2 — CID 143623579
ethane;methyl cyclohexanecarboxylate;(3Z)-3-methylhexa-1,3,5-triene (PubChem CID 143623579) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is ethane;methyl cyclohexanecarboxylate;(3Z)-3-methylhexa-1,3,5-triene.
| Compound Name | ethane;methyl cyclohexanecarboxylate;(3Z)-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 143623579 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | ethane;methyl cyclohexanecarboxylate;(3Z)-3-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C(/C)C=C.CC.CC.COC(=O)C1CCCCC1 |
| InChI | InChI=1S/C8H14O2.C7H10.2C2H6/c1-10-8(9)7-5-3-2-4-6-7;1-4-6-7(3)5-2;2*1-2/h7H,2-6H2,1H3;4-6H,1-2H2,3H3;2*1-2H3/b;7-6-;; |
| InChIKey | YVGPFYMMDQPPJH-MLIOTXERSA-N |
| XLogP | 6.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|