C17H28O2 — CID 145229171
ethane;[(3E)-6-methylhepta-1,3,5-trien-3-yl] cyclohexanecarboxylate (PubChem CID 145229171) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;[(3E)-6-methylhepta-1,3,5-trien-3-yl] cyclohexanecarboxylate.
| Compound Name | ethane;[(3E)-6-methylhepta-1,3,5-trien-3-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 145229171 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | ethane;[(3E)-6-methylhepta-1,3,5-trien-3-yl] cyclohexanecarboxylate |
| SMILES | C=C/C(=C\C=C(C)C)OC(=O)C1CCCCC1.CC |
| InChI | InChI=1S/C15H22O2.C2H6/c1-4-14(11-10-12(2)3)17-15(16)13-8-6-5-7-9-13;1-2/h4,10-11,13H,1,5-9H2,2-3H3;1-2H3/b14-11+; |
| InChIKey | KFDVEUILSQJGJD-JHGYPSGKSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|