C12H14O4 — CID 145204463
[(3E,5E)-6-acetyloxyocta-1,3,5,7-tetraen-3-yl] acetate (PubChem CID 145204463) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is [(3E,5E)-6-acetyloxyocta-1,3,5,7-tetraen-3-yl] acetate.
| Compound Name | [(3E,5E)-6-acetyloxyocta-1,3,5,7-tetraen-3-yl] acetate |
|---|---|
| PubChem CID | 145204463 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | [(3E,5E)-6-acetyloxyocta-1,3,5,7-tetraen-3-yl] acetate |
| SMILES | C=C/C(=C\C=C(/C=C)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C12H14O4/c1-5-11(15-9(3)13)7-8-12(6-2)16-10(4)14/h5-8H,1-2H2,3-4H3/b11-7+,12-8+ |
| InChIKey | GILQWHPOZQQXLB-MKICQXMISA-N |
| XLogP | 2.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|