C24H22O4 — CID 155031076
[(3E,5E)-6-(4-methylbenzoyl)oxyocta-1,3,5,7-tetraen-3-yl] 4-methylbenzoate (PubChem CID 155031076) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is [(3E,5E)-6-(4-methylbenzoyl)oxyocta-1,3,5,7-tetraen-3-yl] 4-methylbenzoate.
| Compound Name | [(3E,5E)-6-(4-methylbenzoyl)oxyocta-1,3,5,7-tetraen-3-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 155031076 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [(3E,5E)-6-(4-methylbenzoyl)oxyocta-1,3,5,7-tetraen-3-yl] 4-methylbenzoate |
| SMILES | C=C/C(=C\C=C(/C=C)OC(=O)c1ccc(C)cc1)OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H22O4/c1-5-21(27-23(25)19-11-7-17(3)8-12-19)15-16-22(6-2)28-24(26)20-13-9-18(4)10-14-20/h5-16H,1-2H2,3-4H3/b21-15+,22-16+ |
| InChIKey | JHICYSCXEMSMLB-YHARCJFQSA-N |
| XLogP | 5.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|