About carbonofluoridoyl 4-methylbenzoate
carbonofluoridoyl 4-methylbenzoate (PubChem CID 143461298) has the molecular formula C9H7FO3
and a molecular weight of 182.15 g/mol. Its IUPAC name is carbonofluoridoyl 4-methylbenzoate.
Molecular Properties
| Compound Name | carbonofluoridoyl 4-methylbenzoate |
| PubChem CID | 143461298 |
| Molecular Formula | C9H7FO3 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | carbonofluoridoyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC(=O)F)cc1 |
| InChI | InChI=1S/C9H7FO3/c1-6-2-4-7(5-3-6)8(11)13-9(10)12/h2-5H,1H3 |
| InChIKey | CXMQCUKLXZICEU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze carbonofluoridoyl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonofluoridoyl 4-methylbenzoate?
The IUPAC name of carbonofluoridoyl 4-methylbenzoate (CID 143461298) is carbonofluoridoyl 4-methylbenzoate.
What is the SMILES notation for carbonofluoridoyl 4-methylbenzoate?
The canonical SMILES for carbonofluoridoyl 4-methylbenzoate is Cc1ccc(C(=O)OC(=O)F)cc1.
What is the InChIKey of carbonofluoridoyl 4-methylbenzoate?
The InChIKey is CXMQCUKLXZICEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO3/c1-6-2-4-7(5-3-6)8(11)13-9(10)12/h2-5H,1H3.
What are the key properties of carbonofluoridoyl 4-methylbenzoate?
carbonofluoridoyl 4-methylbenzoate has a molecular weight of 182.15 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonofluoridoyl 4-methylbenzoate is sourced from PubChem (CID 143461298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).