C15H18O2 — CID 135270665
[(2E)-5-methylhexa-2,4-dien-2-yl] 4-methylbenzoate (PubChem CID 135270665) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is [(2E)-5-methylhexa-2,4-dien-2-yl] 4-methylbenzoate.
| Compound Name | [(2E)-5-methylhexa-2,4-dien-2-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 135270665 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | [(2E)-5-methylhexa-2,4-dien-2-yl] 4-methylbenzoate |
| SMILES | CC(C)=C/C=C(\C)OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H18O2/c1-11(2)5-8-13(4)17-15(16)14-9-6-12(3)7-10-14/h5-10H,1-4H3/b13-8+ |
| InChIKey | VZZQJKIQZXGWBY-MDWZMJQESA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|