C23H28O2 — CID 143238992
(E)-but-2-ene;[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl] 2-methylidenebut-3-enoate (PubChem CID 143238992) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (E)-but-2-ene;[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl] 2-methylidenebut-3-enoate.
| Compound Name | (E)-but-2-ene;[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl] 2-methylidenebut-3-enoate |
|---|---|
| PubChem CID | 143238992 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (E)-but-2-ene;[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl] 2-methylidenebut-3-enoate |
| SMILES | C/C=C/C.C=CC(=C)C(=O)O/C(C)=C/C=C(\C=C)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20O2.C4H8/c1-6-15(4)19(20)21-16(5)10-13-17(7-2)18-11-8-14(3)9-12-18;1-3-4-2/h6-13H,1-2,4H2,3,5H3;3-4H,1-2H3/b16-10+,17-13+;4-3+ |
| InChIKey | RGGNMSVMNKISQT-UYOGSYSKSA-N |
| XLogP | 6.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|