C23H21N — CID 156519406
4-[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl]quinoline (PubChem CID 156519406) has the molecular formula C23H21N and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl]quinoline.
| Compound Name | 4-[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl]quinoline |
|---|---|
| PubChem CID | 156519406 |
| Molecular Formula | C23H21N |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 4-[(2E,4E)-5-(4-methylphenyl)hepta-2,4,6-trien-2-yl]quinoline |
| SMILES | C=C/C(=C\C=C(/C)c1ccnc2ccccc12)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H21N/c1-4-19(20-12-9-17(2)10-13-20)14-11-18(3)21-15-16-24-23-8-6-5-7-22(21)23/h4-16H,1H2,2-3H3/b18-11+,19-14+ |
| InChIKey | SZDMFMWFKQWIAM-MMOYSQFZSA-N |
| XLogP | 6.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|