C20H18N2S — CID 156519407
2-[(3E,5E)-6-(1-benzothiophen-3-yl)hepta-1,3,5-trien-3-yl]-5-methylpyrimidine (PubChem CID 156519407) has the molecular formula C20H18N2S and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-[(3E,5E)-6-(1-benzothiophen-3-yl)hepta-1,3,5-trien-3-yl]-5-methylpyrimidine.
| Compound Name | 2-[(3E,5E)-6-(1-benzothiophen-3-yl)hepta-1,3,5-trien-3-yl]-5-methylpyrimidine |
|---|---|
| PubChem CID | 156519407 |
| Molecular Formula | C20H18N2S |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[(3E,5E)-6-(1-benzothiophen-3-yl)hepta-1,3,5-trien-3-yl]-5-methylpyrimidine |
| SMILES | C=C/C(=C\C=C(/C)c1csc2ccccc12)c1ncc(C)cn1 |
| InChI | InChI=1S/C20H18N2S/c1-4-16(20-21-11-14(2)12-22-20)10-9-15(3)18-13-23-19-8-6-5-7-17(18)19/h4-13H,1H2,2-3H3/b15-9+,16-10+ |
| InChIKey | KCJYARHXRCVSDV-KAVGSWPWSA-N |
| XLogP | 5.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|