C14H19NOS — CID 142071955
1-(1-benzothiophen-3-yl)ethanone;N,N-dimethylethanamine (PubChem CID 142071955) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)ethanone;N,N-dimethylethanamine.
| Compound Name | 1-(1-benzothiophen-3-yl)ethanone;N,N-dimethylethanamine |
|---|---|
| PubChem CID | 142071955 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)ethanone;N,N-dimethylethanamine |
| SMILES | CC(=O)c1csc2ccccc12.CCN(C)C |
| InChI | InChI=1S/C10H8OS.C4H11N/c1-7(11)9-6-12-10-5-3-2-4-8(9)10;1-4-5(2)3/h2-6H,1H3;4H2,1-3H3 |
| InChIKey | USXRUNGIEGAVST-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |