C15H15F2NO2S — CID 62706866
[1-(1-benzothiophen-3-yl)-2,2-difluoroethenyl] N,N-diethylcarbamate (PubChem CID 62706866) has the molecular formula C15H15F2NO2S and a molecular weight of 311.35 g/mol. Its IUPAC name is [1-(1-benzothiophen-3-yl)-2,2-difluoroethenyl] N,N-diethylcarbamate.
| Compound Name | [1-(1-benzothiophen-3-yl)-2,2-difluoroethenyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 62706866 |
| Molecular Formula | C15H15F2NO2S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [1-(1-benzothiophen-3-yl)-2,2-difluoroethenyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OC(=C(F)F)c1csc2ccccc12 |
| InChI | InChI=1S/C15H15F2NO2S/c1-3-18(4-2)15(19)20-13(14(16)17)11-9-21-12-8-6-5-7-10(11)12/h5-9H,3-4H2,1-2H3 |
| InChIKey | TVVFICRFJNIEKS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|