C12H13N3OS2 — CID 22301185
1-(1-benzothiophene-3-carbonylamino)-1-ethylthiourea (PubChem CID 22301185) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 1-(1-benzothiophene-3-carbonylamino)-1-ethylthiourea.
| Compound Name | 1-(1-benzothiophene-3-carbonylamino)-1-ethylthiourea |
|---|---|
| PubChem CID | 22301185 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 1-(1-benzothiophene-3-carbonylamino)-1-ethylthiourea |
| SMILES | CCN(NC(=O)c1csc2ccccc12)C(N)=S |
| InChI | InChI=1S/C12H13N3OS2/c1-2-15(12(13)17)14-11(16)9-7-18-10-6-4-3-5-8(9)10/h3-7H,2H2,1H3,(H2,13,17)(H,14,16) |
| InChIKey | WRZXICFPTDLMRP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|