C14H17N3OS2 — CID 21157628
1-(1-benzothiophene-3-carbonylamino)-1-butylthiourea (PubChem CID 21157628) has the molecular formula C14H17N3OS2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-(1-benzothiophene-3-carbonylamino)-1-butylthiourea.
| Compound Name | 1-(1-benzothiophene-3-carbonylamino)-1-butylthiourea |
|---|---|
| PubChem CID | 21157628 |
| Molecular Formula | C14H17N3OS2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 1-(1-benzothiophene-3-carbonylamino)-1-butylthiourea |
| SMILES | CCCCN(NC(=O)c1csc2ccccc12)C(N)=S |
| InChI | InChI=1S/C14H17N3OS2/c1-2-3-8-17(14(15)19)16-13(18)11-9-20-12-7-5-4-6-10(11)12/h4-7,9H,2-3,8H2,1H3,(H2,15,19)(H,16,18) |
| InChIKey | PAHMVDDXKRAXCS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|