C13H14N2O3S — CID 122148632
N-[2-(2-amino-2-oxoethoxy)ethyl]-1-benzothiophene-3-carboxamide (PubChem CID 122148632) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethoxy)ethyl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 122148632 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)COCCNC(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C13H14N2O3S/c14-12(16)7-18-6-5-15-13(17)10-8-19-11-4-2-1-3-9(10)11/h1-4,8H,5-7H2,(H2,14,16)(H,15,17) |
| InChIKey | OMBZAEUCMWCMNN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|