C15H19NO3S — CID 112723140
N-(2,2-diethoxyethyl)-1-benzothiophene-3-carboxamide (PubChem CID 112723140) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-1-benzothiophene-3-carboxamide.
| Compound Name | N-(2,2-diethoxyethyl)-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 112723140 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-(2,2-diethoxyethyl)-1-benzothiophene-3-carboxamide |
| SMILES | CCOC(CNC(=O)c1csc2ccccc12)OCC |
| InChI | InChI=1S/C15H19NO3S/c1-3-18-14(19-4-2)9-16-15(17)12-10-20-13-8-6-5-7-11(12)13/h5-8,10,14H,3-4,9H2,1-2H3,(H,16,17) |
| InChIKey | VXVYHFLWAKUPCI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|