C15H21NO2S — CID 66977939
N-(1-benzothiophen-3-ylmethyl)-2,2-diethoxyethanamine (PubChem CID 66977939) has the molecular formula C15H21NO2S and a molecular weight of 279.41 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-2,2-diethoxyethanamine.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 66977939 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1csc2ccccc12)OCC |
| InChI | InChI=1S/C15H21NO2S/c1-3-17-15(18-4-2)10-16-9-12-11-19-14-8-6-5-7-13(12)14/h5-8,11,15-16H,3-4,9-10H2,1-2H3 |
| InChIKey | ASVOUTRZRIFXSS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|