C13H16N2O2S — CID 115256146
3-(1-benzothiophen-3-ylmethylamino)-2-(methylamino)propanoic acid (PubChem CID 115256146) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-ylmethylamino)-2-(methylamino)propanoic acid.
| Compound Name | 3-(1-benzothiophen-3-ylmethylamino)-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 115256146 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-(1-benzothiophen-3-ylmethylamino)-2-(methylamino)propanoic acid |
| SMILES | CNC(CNCc1csc2ccccc12)C(=O)O |
| InChI | InChI=1S/C13H16N2O2S/c1-14-11(13(16)17)7-15-6-9-8-18-12-5-3-2-4-10(9)12/h2-5,8,11,14-15H,6-7H2,1H3,(H,16,17) |
| InChIKey | QGQIBUQPJNETII-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |