C11H8F3NO2S — CID 81340322
N-(2,2,2-trifluoroethoxy)-1-benzothiophene-3-carboxamide (PubChem CID 81340322) has the molecular formula C11H8F3NO2S and a molecular weight of 275.25 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethoxy)-1-benzothiophene-3-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethoxy)-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 81340322 |
| Molecular Formula | C11H8F3NO2S |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | N-(2,2,2-trifluoroethoxy)-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NOCC(F)(F)F)c1csc2ccccc12 |
| InChI | InChI=1S/C11H8F3NO2S/c12-11(13,14)6-17-15-10(16)8-5-18-9-4-2-1-3-7(8)9/h1-5H,6H2,(H,15,16) |
| InChIKey | IRJOBZBGPNQCIK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|