C16H21NO3S — CID 136559478
2-(1-benzothiophen-3-yl)-N-(2,2-dimethoxyethyl)-N-ethylacetamide (PubChem CID 136559478) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-N-(2,2-dimethoxyethyl)-N-ethylacetamide.
| Compound Name | 2-(1-benzothiophen-3-yl)-N-(2,2-dimethoxyethyl)-N-ethylacetamide |
|---|---|
| PubChem CID | 136559478 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-N-(2,2-dimethoxyethyl)-N-ethylacetamide |
| SMILES | CCN(CC(OC)OC)C(=O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C16H21NO3S/c1-4-17(10-16(19-2)20-3)15(18)9-12-11-21-14-8-6-5-7-13(12)14/h5-8,11,16H,4,9-10H2,1-3H3 |
| InChIKey | FOLPMEUXJGVFRM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|