C14H12O3S — CID 59961659
6-(1-benzothiophen-3-yl)hexane-2,3,5-trione (PubChem CID 59961659) has the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. Its IUPAC name is 6-(1-benzothiophen-3-yl)hexane-2,3,5-trione.
| Compound Name | 6-(1-benzothiophen-3-yl)hexane-2,3,5-trione |
|---|---|
| PubChem CID | 59961659 |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 6-(1-benzothiophen-3-yl)hexane-2,3,5-trione |
| SMILES | CC(=O)C(=O)CC(=O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C14H12O3S/c1-9(15)13(17)7-11(16)6-10-8-18-14-5-3-2-4-12(10)14/h2-5,8H,6-7H2,1H3 |
| InChIKey | MNMPWPMAMXVPQD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|